C24H26ClFN4O2 — CID 42732632
N-butyl-2-chloro-N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]propanamide (PubChem CID 42732632) has the molecular formula C24H26ClFN4O2 and a molecular weight of 456.95 g/mol. Its IUPAC name is N-butyl-2-chloro-N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]propanamide.
| Compound Name | N-butyl-2-chloro-N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]propanamide |
|---|---|
| PubChem CID | 42732632 |
| Molecular Formula | C24H26ClFN4O2 |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-butyl-2-chloro-N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]propanamide |
| SMILES | CCCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(F)cc1)C(=O)C(C)Cl |
| InChI | InChI=1S/C24H26ClFN4O2/c1-3-4-14-29(24(32)17(2)25)16-23(31)27-22-15-21(18-8-6-5-7-9-18)28-30(22)20-12-10-19(26)11-13-20/h5-13,15,17H,3-4,14,16H2,1-2H3,(H,27,31) |
| InChIKey | KDTGJUWDANBAHH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|