C28H33FN4O2 — CID 3476265
N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopentanecarboxamide (PubChem CID 3476265) has the molecular formula C28H33FN4O2 and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopentanecarboxamide.
| Compound Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopentanecarboxamide |
|---|---|
| PubChem CID | 3476265 |
| Molecular Formula | C28H33FN4O2 |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopentanecarboxamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(F)cc1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C28H33FN4O2/c1-2-3-9-18-32(28(35)22-12-7-8-13-22)20-27(34)30-26-19-25(21-10-5-4-6-11-21)31-33(26)24-16-14-23(29)15-17-24/h4-6,10-11,14-17,19,22H,2-3,7-9,12-13,18,20H2,1H3,(H,30,34) |
| InChIKey | UMBWVSDFBKXDPC-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|