C32H34N4O2 — CID 92993597
trans-(1R,2R)-N-[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl]-N-pentyl-2-phenylcyclopropane-1-carboxamide (PubChem CID 92993597) has the molecular formula C32H34N4O2 and a molecular weight of 506.65 g/mol. Its IUPAC name is trans-(1R,2R)-N-[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl]-N-pentyl-2-phenylcyclopropane-1-carboxamide.
| Compound Name | trans-(1R,2R)-N-[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl]-N-pentyl-2-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 92993597 |
| Molecular Formula | C32H34N4O2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | trans-(1R,2R)-N-[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl]-N-pentyl-2-phenylcyclopropane-1-carboxamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccccc1)C(=O)[C@@H]1C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H34N4O2/c1-2-3-13-20-35(32(38)28-21-27(28)24-14-7-4-8-15-24)23-31(37)33-30-22-29(25-16-9-5-10-17-25)34-36(30)26-18-11-6-12-19-26/h4-12,14-19,22,27-28H,2-3,13,20-21,23H2,1H3,(H,33,37)/t27-,28+/m0/s1 |
| InChIKey | OIHGTFLSOGAFGO-WUFINQPMSA-N |
| XLogP | 6.30 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|