C36H36N4O2 — CID 5107189
N-[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl]-N-pentyl-2,2-diphenylacetamide (PubChem CID 5107189) has the molecular formula C36H36N4O2 and a molecular weight of 556.71 g/mol. Its IUPAC name is N-[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl]-N-pentyl-2,2-diphenylacetamide.
| Compound Name | N-[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl]-N-pentyl-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 5107189 |
| Molecular Formula | C36H36N4O2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | N-[2-[(1,3-diphenylpyrazol-5-yl)amino]-2-oxoethyl]-N-pentyl-2,2-diphenylacetamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccccc1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H36N4O2/c1-2-3-16-25-39(36(42)35(29-19-10-5-11-20-29)30-21-12-6-13-22-30)27-34(41)37-33-26-32(28-17-8-4-9-18-28)38-40(33)31-23-14-7-15-24-31/h4-15,17-24,26,35H,2-3,16,25,27H2,1H3,(H,37,41) |
| InChIKey | GCXNOIQDJJXAHJ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|