C29H31FN4O3 — CID 4304443
N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-(furan-2-ylmethyl)heptanamide (PubChem CID 4304443) has the molecular formula C29H31FN4O3 and a molecular weight of 502.59 g/mol. Its IUPAC name is N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-(furan-2-ylmethyl)heptanamide.
| Compound Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-(furan-2-ylmethyl)heptanamide |
|---|---|
| PubChem CID | 4304443 |
| Molecular Formula | C29H31FN4O3 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | N-[2-[[1-(4-fluorophenyl)-3-phenylpyrazol-5-yl]amino]-2-oxoethyl]-N-(furan-2-ylmethyl)heptanamide |
| SMILES | CCCCCCC(=O)N(CC(=O)Nc1cc(-c2ccccc2)nn1-c1ccc(F)cc1)Cc1ccco1 |
| InChI | InChI=1S/C29H31FN4O3/c1-2-3-4-8-13-29(36)33(20-25-12-9-18-37-25)21-28(35)31-27-19-26(22-10-6-5-7-11-22)32-34(27)24-16-14-23(30)15-17-24/h5-7,9-12,14-19H,2-4,8,13,20-21H2,1H3,(H,31,35) |
| InChIKey | KQAHPFNRFGKEAD-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|