C31H44N4O3 — CID 4238107
N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(furan-2-ylmethyl)decanamide (PubChem CID 4238107) has the molecular formula C31H44N4O3 and a molecular weight of 520.72 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(furan-2-ylmethyl)decanamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(furan-2-ylmethyl)decanamide |
|---|---|
| PubChem CID | 4238107 |
| Molecular Formula | C31H44N4O3 |
| Molecular Weight | 520.72 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-(furan-2-ylmethyl)decanamide |
| SMILES | CCCCCCCCCC(=O)N(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1C)Cc1ccco1 |
| InChI | InChI=1S/C31H44N4O3/c1-6-7-8-9-10-11-12-19-30(37)34(22-25-17-15-20-38-25)23-29(36)32-28-21-27(31(3,4)5)33-35(28)26-18-14-13-16-24(26)2/h13-18,20-21H,6-12,19,22-23H2,1-5H3,(H,32,36) |
| InChIKey | SOQAHPRIRILMSN-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.72 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|