C30H40N4O2 — CID 5140232
N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-pentylbenzamide (PubChem CID 5140232) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-pentylbenzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-pentylbenzamide |
|---|---|
| PubChem CID | 5140232 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CC)CC(=O)Nc2cc(C(C)(C)C)nn2-c2ccccc2C)cc1 |
| InChI | InChI=1S/C30H40N4O2/c1-7-9-10-14-23-16-18-24(19-17-23)29(36)33(8-2)21-28(35)31-27-20-26(30(4,5)6)32-34(27)25-15-12-11-13-22(25)3/h11-13,15-20H,7-10,14,21H2,1-6H3,(H,31,35) |
| InChIKey | JKPZZBHGIMBMHL-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|