C29H37ClN4O2 — CID 42732134
N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-pentylbenzamide (PubChem CID 42732134) has the molecular formula C29H37ClN4O2 and a molecular weight of 509.09 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-pentylbenzamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-pentylbenzamide |
|---|---|
| PubChem CID | 42732134 |
| Molecular Formula | C29H37ClN4O2 |
| Molecular Weight | 509.09 g/mol |
| Exact Mass | 508.26 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-ethyl-4-pentylbenzamide |
| SMILES | CCCCCc1ccc(C(=O)N(CC)CC(=O)Nc2cc(C(C)(C)C)nn2-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C29H37ClN4O2/c1-6-8-9-12-21-15-17-22(18-16-21)28(36)33(7-2)20-27(35)31-26-19-25(29(3,4)5)32-34(26)24-14-11-10-13-23(24)30/h10-11,13-19H,6-9,12,20H2,1-5H3,(H,31,35) |
| InChIKey | GDZAXLVQPNOFRP-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.09 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|