C25H35ClN4O2 — CID 4573396
N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclobutanecarboxamide (PubChem CID 4573396) has the molecular formula C25H35ClN4O2 and a molecular weight of 459.03 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclobutanecarboxamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclobutanecarboxamide |
|---|---|
| PubChem CID | 4573396 |
| Molecular Formula | C25H35ClN4O2 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclobutanecarboxamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl)C(=O)C1CCC1 |
| InChI | InChI=1S/C25H35ClN4O2/c1-5-6-9-15-29(24(32)18-11-10-12-18)17-23(31)27-22-16-21(25(2,3)4)28-30(22)20-14-8-7-13-19(20)26/h7-8,13-14,16,18H,5-6,9-12,15,17H2,1-4H3,(H,27,31) |
| InChIKey | LCIILBAGAKANQH-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|