C27H39ClN4O2 — CID 42735818
N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclohexanecarboxamide (PubChem CID 42735818) has the molecular formula C27H39ClN4O2 and a molecular weight of 487.09 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclohexanecarboxamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 42735818 |
| Molecular Formula | C27H39ClN4O2 |
| Molecular Weight | 487.09 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclohexanecarboxamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl)C(=O)C1CCCCC1 |
| InChI | InChI=1S/C27H39ClN4O2/c1-5-6-12-17-31(26(34)20-13-8-7-9-14-20)19-25(33)29-24-18-23(27(2,3)4)30-32(24)22-16-11-10-15-21(22)28/h10-11,15-16,18,20H,5-9,12-14,17,19H2,1-4H3,(H,29,33) |
| InChIKey | CDGZOUFDHCDYMX-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.09 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|