C26H37ClN4O2 — CID 42735824
N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopentanecarboxamide (PubChem CID 42735824) has the molecular formula C26H37ClN4O2 and a molecular weight of 473.06 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopentanecarboxamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopentanecarboxamide |
|---|---|
| PubChem CID | 42735824 |
| Molecular Formula | C26H37ClN4O2 |
| Molecular Weight | 473.06 g/mol |
| Exact Mass | 472.26 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopentanecarboxamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl)C(=O)C1CCCC1 |
| InChI | InChI=1S/C26H37ClN4O2/c1-5-6-11-16-30(25(33)19-12-7-8-13-19)18-24(32)28-23-17-22(26(2,3)4)29-31(23)21-15-10-9-14-20(21)27/h9-10,14-15,17,19H,5-8,11-13,16,18H2,1-4H3,(H,28,32) |
| InChIKey | HWUYPHNTHMEDBP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.06 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|