C25H36N4O2 — CID 42735593
N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopropanecarboxamide (PubChem CID 42735593) has the molecular formula C25H36N4O2 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopropanecarboxamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopropanecarboxamide |
|---|---|
| PubChem CID | 42735593 |
| Molecular Formula | C25H36N4O2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-methylphenyl)pyrazol-5-yl]amino]-2-oxoethyl]-N-pentylcyclopropanecarboxamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1C)C(=O)C1CC1 |
| InChI | InChI=1S/C25H36N4O2/c1-6-7-10-15-28(24(31)19-13-14-19)17-23(30)26-22-16-21(25(3,4)5)27-29(22)20-12-9-8-11-18(20)2/h8-9,11-12,16,19H,6-7,10,13-15,17H2,1-5H3,(H,26,30) |
| InChIKey | VUPNLUUCVRZLOG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|