C29H32ClF6N5O2 — CID 5032553
2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-pentylamino]-N-[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]acetamide (PubChem CID 5032553) has the molecular formula C29H32ClF6N5O2 and a molecular weight of 632.05 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-pentylamino]-N-[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]acetamide.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-pentylamino]-N-[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 5032553 |
| Molecular Formula | C29H32ClF6N5O2 |
| Molecular Weight | 632.05 g/mol |
| Exact Mass | 631.21 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]carbamoyl-pentylamino]-N-[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]acetamide |
| SMILES | CCCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl)C(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H32ClF6N5O2/c1-5-6-9-12-40(26(43)37-20-14-18(28(31,32)33)13-19(15-20)29(34,35)36)17-25(42)38-24-16-23(27(2,3)4)39-41(24)22-11-8-7-10-21(22)30/h7-8,10-11,13-16H,5-6,9,12,17H2,1-4H3,(H,37,43)(H,38,42) |
| InChIKey | XEUFBGBTMWIYQY-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.05 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|