C24H35ClN4O2 — CID 42732317
N-butyl-N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]pentanamide (PubChem CID 42732317) has the molecular formula C24H35ClN4O2 and a molecular weight of 447.02 g/mol. Its IUPAC name is N-butyl-N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]pentanamide.
| Compound Name | N-butyl-N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]pentanamide |
|---|---|
| PubChem CID | 42732317 |
| Molecular Formula | C24H35ClN4O2 |
| Molecular Weight | 447.02 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | N-butyl-N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]pentanamide |
| SMILES | CCCCC(=O)N(CCCC)CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C24H35ClN4O2/c1-6-8-14-23(31)28(15-9-7-2)17-22(30)26-21-16-20(24(3,4)5)27-29(21)19-13-11-10-12-18(19)25/h10-13,16H,6-9,14-15,17H2,1-5H3,(H,26,30) |
| InChIKey | XARVDYYHZZXWHY-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.02 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |