C21H28Cl2N4O2 — CID 3536089
N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2-chloro-N-propylpropanamide (PubChem CID 3536089) has the molecular formula C21H28Cl2N4O2 and a molecular weight of 439.39 g/mol. Its IUPAC name is N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2-chloro-N-propylpropanamide.
| Compound Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2-chloro-N-propylpropanamide |
|---|---|
| PubChem CID | 3536089 |
| Molecular Formula | C21H28Cl2N4O2 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]-2-chloro-N-propylpropanamide |
| SMILES | CCCN(CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl)C(=O)C(C)Cl |
| InChI | InChI=1S/C21H28Cl2N4O2/c1-6-11-26(20(29)14(2)22)13-19(28)24-18-12-17(21(3,4)5)25-27(18)16-10-8-7-9-15(16)23/h7-10,12,14H,6,11,13H2,1-5H3,(H,24,28) |
| InChIKey | UYNIQHOSMBOXOA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|