C28H43ClN4O2 — CID 4253712
N-butyl-N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]nonanamide (PubChem CID 4253712) has the molecular formula C28H43ClN4O2 and a molecular weight of 503.13 g/mol. Its IUPAC name is N-butyl-N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]nonanamide.
| Compound Name | N-butyl-N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]nonanamide |
|---|---|
| PubChem CID | 4253712 |
| Molecular Formula | C28H43ClN4O2 |
| Molecular Weight | 503.13 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | N-butyl-N-[2-[[3-tert-butyl-1-(2-chlorophenyl)pyrazol-5-yl]amino]-2-oxoethyl]nonanamide |
| SMILES | CCCCCCCCC(=O)N(CCCC)CC(=O)Nc1cc(C(C)(C)C)nn1-c1ccccc1Cl |
| InChI | InChI=1S/C28H43ClN4O2/c1-6-8-10-11-12-13-18-27(35)32(19-9-7-2)21-26(34)30-25-20-24(28(3,4)5)31-33(25)23-17-15-14-16-22(23)29/h14-17,20H,6-13,18-19,21H2,1-5H3,(H,30,34) |
| InChIKey | NLCLJBKWAMWSDM-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.13 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|