C21H38N4O2 — CID 42740507
N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]heptanamide (PubChem CID 42740507) has the molecular formula C21H38N4O2 and a molecular weight of 378.56 g/mol. Its IUPAC name is N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]heptanamide.
| Compound Name | N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]heptanamide |
|---|---|
| PubChem CID | 42740507 |
| Molecular Formula | C21H38N4O2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]heptanamide |
| SMILES | CCCCCCC(=O)N(CCCC)CC(=O)Nc1cc(C(C)(C)C)nn1C |
| InChI | InChI=1S/C21H38N4O2/c1-7-9-11-12-13-20(27)25(14-10-8-2)16-19(26)22-18-15-17(21(3,4)5)23-24(18)6/h15H,7-14,16H2,1-6H3,(H,22,26) |
| InChIKey | OJQATSYBISDDCK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|