C16H26Cl2N4O2 — CID 42740466
N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2,2-dichloroacetamide (PubChem CID 42740466) has the molecular formula C16H26Cl2N4O2 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2,2-dichloroacetamide.
| Compound Name | N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2,2-dichloroacetamide |
|---|---|
| PubChem CID | 42740466 |
| Molecular Formula | C16H26Cl2N4O2 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2,2-dichloroacetamide |
| SMILES | CCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1C)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C16H26Cl2N4O2/c1-6-7-8-22(15(24)14(17)18)10-13(23)19-12-9-11(16(2,3)4)20-21(12)5/h9,14H,6-8,10H2,1-5H3,(H,19,23) |
| InChIKey | KVQFPOIHLDOCLM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|