C15H24Cl2N4O2 — CID 1060776
N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2,2-dichloro-N-propylacetamide (PubChem CID 1060776) has the molecular formula C15H24Cl2N4O2 and a molecular weight of 363.29 g/mol. Its IUPAC name is N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2,2-dichloro-N-propylacetamide.
| Compound Name | N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2,2-dichloro-N-propylacetamide |
|---|---|
| PubChem CID | 1060776 |
| Molecular Formula | C15H24Cl2N4O2 |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2,2-dichloro-N-propylacetamide |
| SMILES | CCCN(CC(=O)Nc1cc(C(C)(C)C)nn1C)C(=O)C(Cl)Cl |
| InChI | InChI=1S/C15H24Cl2N4O2/c1-6-7-21(14(23)13(16)17)9-12(22)18-11-8-10(15(2,3)4)19-20(11)5/h8,13H,6-7,9H2,1-5H3,(H,18,22) |
| InChIKey | WHHQWBFVXQACJE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|