C22H31ClN4O2 — CID 4556483
N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2-chloro-2-phenylacetamide (PubChem CID 4556483) has the molecular formula C22H31ClN4O2 and a molecular weight of 418.97 g/mol. Its IUPAC name is N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2-chloro-2-phenylacetamide.
| Compound Name | N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2-chloro-2-phenylacetamide |
|---|---|
| PubChem CID | 4556483 |
| Molecular Formula | C22H31ClN4O2 |
| Molecular Weight | 418.97 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | N-butyl-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2-chloro-2-phenylacetamide |
| SMILES | CCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1C)C(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C22H31ClN4O2/c1-6-7-13-27(21(29)20(23)16-11-9-8-10-12-16)15-19(28)24-18-14-17(22(2,3)4)25-26(18)5/h8-12,14,20H,6-7,13,15H2,1-5H3,(H,24,28) |
| InChIKey | RNOLXWSGTXDYGK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.97 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|