C21H29ClN4O2 — CID 1060774
(2R)-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2-chloro-2-phenyl-N-propan-2-ylacetamide (PubChem CID 1060774) has the molecular formula C21H29ClN4O2 and a molecular weight of 404.94 g/mol. Its IUPAC name is (2R)-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2-chloro-2-phenyl-N-propan-2-ylacetamide.
| Compound Name | (2R)-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2-chloro-2-phenyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 1060774 |
| Molecular Formula | C21H29ClN4O2 |
| Molecular Weight | 404.94 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (2R)-N-[2-[(3-tert-butyl-1-methylpyrazol-5-yl)amino]-2-oxoethyl]-2-chloro-2-phenyl-N-propan-2-ylacetamide |
| SMILES | CC(C)N(CC(=O)Nc1cc(C(C)(C)C)nn1C)C(=O)[C@H](Cl)c1ccccc1 |
| InChI | InChI=1S/C21H29ClN4O2/c1-14(2)26(20(28)19(22)15-10-8-7-9-11-15)13-18(27)23-17-12-16(21(3,4)5)24-25(17)6/h7-12,14,19H,13H2,1-6H3,(H,23,27)/t19-/m1/s1 |
| InChIKey | QDIRNMFZHBOJTR-LJQANCHMSA-N |
| XLogP | 3.87 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.94 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|