C25H37ClN4O2 — CID 3621663
N-butyl-2-chloro-N-[2-[(1,3-ditert-butylpyrazol-5-yl)amino]-2-oxoethyl]-2-phenylacetamide (PubChem CID 3621663) has the molecular formula C25H37ClN4O2 and a molecular weight of 461.05 g/mol. Its IUPAC name is N-butyl-2-chloro-N-[2-[(1,3-ditert-butylpyrazol-5-yl)amino]-2-oxoethyl]-2-phenylacetamide.
| Compound Name | N-butyl-2-chloro-N-[2-[(1,3-ditert-butylpyrazol-5-yl)amino]-2-oxoethyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 3621663 |
| Molecular Formula | C25H37ClN4O2 |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | N-butyl-2-chloro-N-[2-[(1,3-ditert-butylpyrazol-5-yl)amino]-2-oxoethyl]-2-phenylacetamide |
| SMILES | CCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1C(C)(C)C)C(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C25H37ClN4O2/c1-8-9-15-29(23(32)22(26)18-13-11-10-12-14-18)17-21(31)27-20-16-19(24(2,3)4)28-30(20)25(5,6)7/h10-14,16,22H,8-9,15,17H2,1-7H3,(H,27,31) |
| InChIKey | IJZMRPFTWQNUMJ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|