C22H32N4O2S — CID 42740512
N-(3-tert-butyl-1-methylpyrazol-5-yl)-2-[butyl-(2-phenylsulfanylacetyl)amino]acetamide (PubChem CID 42740512) has the molecular formula C22H32N4O2S and a molecular weight of 416.59 g/mol. Its IUPAC name is N-(3-tert-butyl-1-methylpyrazol-5-yl)-2-[butyl-(2-phenylsulfanylacetyl)amino]acetamide.
| Compound Name | N-(3-tert-butyl-1-methylpyrazol-5-yl)-2-[butyl-(2-phenylsulfanylacetyl)amino]acetamide |
|---|---|
| PubChem CID | 42740512 |
| Molecular Formula | C22H32N4O2S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | N-(3-tert-butyl-1-methylpyrazol-5-yl)-2-[butyl-(2-phenylsulfanylacetyl)amino]acetamide |
| SMILES | CCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1C)C(=O)CSc1ccccc1 |
| InChI | InChI=1S/C22H32N4O2S/c1-6-7-13-26(21(28)16-29-17-11-9-8-10-12-17)15-20(27)23-19-14-18(22(2,3)4)24-25(19)5/h8-12,14H,6-7,13,15-16H2,1-5H3,(H,23,27) |
| InChIKey | FYDGFTJOVIZPQO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |