C16H28N4O2 — CID 42740478
2-[acetyl(butyl)amino]-N-(3-tert-butyl-1-methylpyrazol-5-yl)acetamide (PubChem CID 42740478) has the molecular formula C16H28N4O2 and a molecular weight of 308.43 g/mol. Its IUPAC name is 2-[acetyl(butyl)amino]-N-(3-tert-butyl-1-methylpyrazol-5-yl)acetamide.
| Compound Name | 2-[acetyl(butyl)amino]-N-(3-tert-butyl-1-methylpyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 42740478 |
| Molecular Formula | C16H28N4O2 |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 2-[acetyl(butyl)amino]-N-(3-tert-butyl-1-methylpyrazol-5-yl)acetamide |
| SMILES | CCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1C)C(C)=O |
| InChI | InChI=1S/C16H28N4O2/c1-7-8-9-20(12(2)21)11-15(22)17-14-10-13(16(3,4)5)18-19(14)6/h10H,7-9,11H2,1-6H3,(H,17,22) |
| InChIKey | BUARFVMNEGCYSH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |