C20H29FN4O3S — CID 3942291
2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(3-tert-butyl-1-methylpyrazol-5-yl)acetamide (PubChem CID 3942291) has the molecular formula C20H29FN4O3S and a molecular weight of 424.54 g/mol. Its IUPAC name is 2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(3-tert-butyl-1-methylpyrazol-5-yl)acetamide.
| Compound Name | 2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(3-tert-butyl-1-methylpyrazol-5-yl)acetamide |
|---|---|
| PubChem CID | 3942291 |
| Molecular Formula | C20H29FN4O3S |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(3-tert-butyl-1-methylpyrazol-5-yl)acetamide |
| SMILES | CCCCN(CC(=O)Nc1cc(C(C)(C)C)nn1C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H29FN4O3S/c1-6-7-12-25(29(27,28)16-10-8-15(21)9-11-16)14-19(26)22-18-13-17(20(2,3)4)23-24(18)5/h8-11,13H,6-7,12,14H2,1-5H3,(H,22,26) |
| InChIKey | RSYNZDIDYHAVFG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |