C15H18FN3O3S2 — CID 5179961
2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 5179961) has the molecular formula C15H18FN3O3S2 and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 5179961 |
| Molecular Formula | C15H18FN3O3S2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 2-[butyl-(4-fluorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | CCCCN(CC(=O)Nc1nccs1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H18FN3O3S2/c1-2-3-9-19(11-14(20)18-15-17-8-10-23-15)24(21,22)13-6-4-12(16)5-7-13/h4-8,10H,2-3,9,11H2,1H3,(H,17,18,20) |
| InChIKey | FASNAAMDOFEFIN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |