C13H14FN3O3S2 — CID 110502528
2-[(4-fluorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)butanamide (PubChem CID 110502528) has the molecular formula C13H14FN3O3S2 and a molecular weight of 343.41 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)butanamide.
| Compound Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 110502528 |
| Molecular Formula | C13H14FN3O3S2 |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | 2-[(4-fluorophenyl)sulfonylamino]-N-(1,3-thiazol-2-yl)butanamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C13H14FN3O3S2/c1-2-11(12(18)16-13-15-7-8-21-13)17-22(19,20)10-5-3-9(14)4-6-10/h3-8,11,17H,2H2,1H3,(H,15,16,18) |
| InChIKey | SRFLEVIBUTUGJX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |