C18H21FN2O3S — CID 110499244
N-(3,5-dimethylphenyl)-2-[(4-fluorophenyl)sulfonylamino]butanamide (PubChem CID 110499244) has the molecular formula C18H21FN2O3S and a molecular weight of 364.44 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-2-[(4-fluorophenyl)sulfonylamino]butanamide.
| Compound Name | N-(3,5-dimethylphenyl)-2-[(4-fluorophenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 110499244 |
| Molecular Formula | C18H21FN2O3S |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-(3,5-dimethylphenyl)-2-[(4-fluorophenyl)sulfonylamino]butanamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H21FN2O3S/c1-4-17(18(22)20-15-10-12(2)9-13(3)11-15)21-25(23,24)16-7-5-14(19)6-8-16/h5-11,17,21H,4H2,1-3H3,(H,20,22) |
| InChIKey | RJMJMSXFGQFJCK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |