C21H28FN3O3S — CID 110499213
N-[4-(diethylamino)-2-methylphenyl]-2-[(4-fluorophenyl)sulfonylamino]butanamide (PubChem CID 110499213) has the molecular formula C21H28FN3O3S and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-[(4-fluorophenyl)sulfonylamino]butanamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-[(4-fluorophenyl)sulfonylamino]butanamide |
|---|---|
| PubChem CID | 110499213 |
| Molecular Formula | C21H28FN3O3S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-[(4-fluorophenyl)sulfonylamino]butanamide |
| SMILES | CCC(NS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1ccc(N(CC)CC)cc1C |
| InChI | InChI=1S/C21H28FN3O3S/c1-5-19(24-29(27,28)18-11-8-16(22)9-12-18)21(26)23-20-13-10-17(14-15(20)4)25(6-2)7-3/h8-14,19,24H,5-7H2,1-4H3,(H,23,26) |
| InChIKey | BWYLFPFXOZQFJH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|