C20H23FN2O5S — CID 110499299
propan-2-yl 3-[2-[(4-fluorophenyl)sulfonylamino]butanoylamino]benzoate (PubChem CID 110499299) has the molecular formula C20H23FN2O5S and a molecular weight of 422.48 g/mol. Its IUPAC name is propan-2-yl 3-[2-[(4-fluorophenyl)sulfonylamino]butanoylamino]benzoate.
| Compound Name | propan-2-yl 3-[2-[(4-fluorophenyl)sulfonylamino]butanoylamino]benzoate |
|---|---|
| PubChem CID | 110499299 |
| Molecular Formula | C20H23FN2O5S |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | propan-2-yl 3-[2-[(4-fluorophenyl)sulfonylamino]butanoylamino]benzoate |
| SMILES | CCC(NS(=O)(=O)c1ccc(F)cc1)C(=O)Nc1cccc(C(=O)OC(C)C)c1 |
| InChI | InChI=1S/C20H23FN2O5S/c1-4-18(23-29(26,27)17-10-8-15(21)9-11-17)19(24)22-16-7-5-6-14(12-16)20(25)28-13(2)3/h5-13,18,23H,4H2,1-3H3,(H,22,24) |
| InChIKey | GKKQPUDIVOKTRM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |