C20H21FN2O6S — CID 42900320
[1-(3-acetylanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]propanoate (PubChem CID 42900320) has the molecular formula C20H21FN2O6S and a molecular weight of 436.46 g/mol. Its IUPAC name is [1-(3-acetylanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | [1-(3-acetylanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 42900320 |
| Molecular Formula | C20H21FN2O6S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | [1-(3-acetylanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]propanoate |
| SMILES | CC(=O)c1cccc(NC(=O)C(C)OC(=O)C(C)NS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H21FN2O6S/c1-12(23-30(27,28)18-9-7-16(21)8-10-18)20(26)29-14(3)19(25)22-17-6-4-5-15(11-17)13(2)24/h4-12,14,23H,1-3H3,(H,22,25) |
| InChIKey | SQIHNWWFWGPDCL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |