C19H18FN3O5S — CID 42900322
[1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]propanoate (PubChem CID 42900322) has the molecular formula C19H18FN3O5S and a molecular weight of 419.43 g/mol. Its IUPAC name is [1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 42900322 |
| Molecular Formula | C19H18FN3O5S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 2-[(4-fluorophenyl)sulfonylamino]propanoate |
| SMILES | CC(NS(=O)(=O)c1ccc(F)cc1)C(=O)OC(C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H18FN3O5S/c1-12(23-29(26,27)17-8-6-15(20)7-9-17)19(25)28-13(2)18(24)22-16-5-3-4-14(10-16)11-21/h3-10,12-13,23H,1-2H3,(H,22,24) |
| InChIKey | RBCJJNWJGGRRJP-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |