C12H13FN2O4S — CID 7609271
[(1R)-1-cyanoethyl] (2S)-2-[(4-fluorophenyl)sulfonylamino]propanoate (PubChem CID 7609271) has the molecular formula C12H13FN2O4S and a molecular weight of 300.31 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] (2S)-2-[(4-fluorophenyl)sulfonylamino]propanoate.
| Compound Name | [(1R)-1-cyanoethyl] (2S)-2-[(4-fluorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7609271 |
| Molecular Formula | C12H13FN2O4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [(1R)-1-cyanoethyl] (2S)-2-[(4-fluorophenyl)sulfonylamino]propanoate |
| SMILES | C[C@H](C#N)OC(=O)[C@H](C)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2O4S/c1-8(7-14)19-12(16)9(2)15-20(17,18)11-5-3-10(13)4-6-11/h3-6,8-9,15H,1-2H3/t8-,9+/m1/s1 |
| InChIKey | XDUYYQJTYRXMTP-BDAKNGLRSA-N |
| XLogP | 0.95 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |