C14H16N2O5S — CID 8939367
[(1R)-1-cyanoethyl] (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoate (PubChem CID 8939367) has the molecular formula C14H16N2O5S and a molecular weight of 324.36 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoate.
| Compound Name | [(1R)-1-cyanoethyl] (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 8939367 |
| Molecular Formula | C14H16N2O5S |
| Molecular Weight | 324.36 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | [(1R)-1-cyanoethyl] (2S)-2-[(4-acetylphenyl)sulfonylamino]propanoate |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N[C@@H](C)C(=O)O[C@H](C)C#N)cc1 |
| InChI | InChI=1S/C14H16N2O5S/c1-9(8-15)21-14(18)10(2)16-22(19,20)13-6-4-12(5-7-13)11(3)17/h4-7,9-10,16H,1-3H3/t9-,10+/m1/s1 |
| InChIKey | RYCOHVHHKQKAHN-ZJUUUORDSA-N |
| XLogP | 1.01 |
| TPSA | 113.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.36 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |