C15H19N3O5S — CID 7979620
[(1R)-1-cyanoethyl] 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetate (PubChem CID 7979620) has the molecular formula C15H19N3O5S and a molecular weight of 353.40 g/mol. Its IUPAC name is [(1R)-1-cyanoethyl] 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | [(1R)-1-cyanoethyl] 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 7979620 |
| Molecular Formula | C15H19N3O5S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | [(1R)-1-cyanoethyl] 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)NCC(=O)O[C@H](C)C#N)cc1 |
| InChI | InChI=1S/C15H19N3O5S/c1-10(2)18-24(21,22)13-6-4-12(5-7-13)15(20)17-9-14(19)23-11(3)8-16/h4-7,10-11,18H,9H2,1-3H3,(H,17,20)/t11-/m1/s1 |
| InChIKey | RGJYJPYEESGXKQ-LLVKDONJSA-N |
| XLogP | 0.56 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |