C14H17N3O5S — CID 7979636
cyanomethyl 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetate (PubChem CID 7979636) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is cyanomethyl 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetate.
| Compound Name | cyanomethyl 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 7979636 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | cyanomethyl 2-[[4-(propan-2-ylsulfamoyl)benzoyl]amino]acetate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(C(=O)NCC(=O)OCC#N)cc1 |
| InChI | InChI=1S/C14H17N3O5S/c1-10(2)17-23(20,21)12-5-3-11(4-6-12)14(19)16-9-13(18)22-8-7-15/h3-6,10,17H,8-9H2,1-2H3,(H,16,19) |
| InChIKey | FHJKZCSEIAKEOM-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |