C13H16N2O5S — CID 41143254
cyanomethyl 4-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoate (PubChem CID 41143254) has the molecular formula C13H16N2O5S and a molecular weight of 312.35 g/mol. Its IUPAC name is cyanomethyl 4-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoate.
| Compound Name | cyanomethyl 4-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoate |
|---|---|
| PubChem CID | 41143254 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | cyanomethyl 4-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzoate |
| SMILES | COC[C@@H](C)NS(=O)(=O)c1ccc(C(=O)OCC#N)cc1 |
| InChI | InChI=1S/C13H16N2O5S/c1-10(9-19-2)15-21(17,18)12-5-3-11(4-6-12)13(16)20-8-7-14/h3-6,10,15H,8-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | LVXOZDLYWDGWRF-SNVBAGLBSA-N |
| XLogP | 0.68 |
| TPSA | 105.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |