C17H21N3O6S2 — CID 42909880
4-(1-methoxypropan-2-ylsulfamoyl)-N-(4-sulfamoylphenyl)benzamide (PubChem CID 42909880) has the molecular formula C17H21N3O6S2 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-(1-methoxypropan-2-ylsulfamoyl)-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 4-(1-methoxypropan-2-ylsulfamoyl)-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 42909880 |
| Molecular Formula | C17H21N3O6S2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 4-(1-methoxypropan-2-ylsulfamoyl)-N-(4-sulfamoylphenyl)benzamide |
| SMILES | COCC(C)NS(=O)(=O)c1ccc(C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C17H21N3O6S2/c1-12(11-26-2)20-28(24,25)16-7-3-13(4-8-16)17(21)19-14-5-9-15(10-6-14)27(18,22)23/h3-10,12,20H,11H2,1-2H3,(H,19,21)(H2,18,22,23) |
| InChIKey | AJWVCDMIFQUZHM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |