C18H19F3N2O4S2 — CID 46616213
N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 46616213) has the molecular formula C18H19F3N2O4S2 and a molecular weight of 448.49 g/mol. Its IUPAC name is N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 46616213 |
| Molecular Formula | C18H19F3N2O4S2 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | N-[4-(1-methoxypropan-2-ylsulfamoyl)phenyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | COCC(C)NS(=O)(=O)c1ccc(NC(=O)c2ccc(SC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H19F3N2O4S2/c1-12(11-27-2)23-29(25,26)16-9-5-14(6-10-16)22-17(24)13-3-7-15(8-4-13)28-18(19,20)21/h3-10,12,23H,11H2,1-2H3,(H,22,24) |
| InChIKey | QPHNDRQHXRPIPQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |