C19H24N2O4S — CID 9342410
N-(2,3-dimethylphenyl)-4-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]benzamide (PubChem CID 9342410) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-4-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]benzamide.
| Compound Name | N-(2,3-dimethylphenyl)-4-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 9342410 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(2,3-dimethylphenyl)-4-[[(2S)-1-methoxypropan-2-yl]sulfamoyl]benzamide |
| SMILES | COC[C@H](C)NS(=O)(=O)c1ccc(C(=O)Nc2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-13-6-5-7-18(15(13)3)20-19(22)16-8-10-17(11-9-16)26(23,24)21-14(2)12-25-4/h5-11,14,21H,12H2,1-4H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | JPYIFPIEPWKWNL-AWEZNQCLSA-N |
| XLogP | 2.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |