C18H15F3N2O4S — CID 46636688
methyl 2-[[4-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzoyl]amino]acetate (PubChem CID 46636688) has the molecular formula C18H15F3N2O4S and a molecular weight of 412.39 g/mol. Its IUPAC name is methyl 2-[[4-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 46636688 |
| Molecular Formula | C18H15F3N2O4S |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | methyl 2-[[4-[[4-(trifluoromethylsulfanyl)benzoyl]amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)c2ccc(SC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H15F3N2O4S/c1-27-15(24)10-22-16(25)11-2-6-13(7-3-11)23-17(26)12-4-8-14(9-5-12)28-18(19,20)21/h2-9H,10H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | LXKBNLJWUANYAN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |