C17H15FN2O4 — CID 9049144
methyl 2-[[4-[(4-fluorobenzoyl)amino]benzoyl]amino]acetate (PubChem CID 9049144) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is methyl 2-[[4-[(4-fluorobenzoyl)amino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[(4-fluorobenzoyl)amino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 9049144 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | methyl 2-[[4-[(4-fluorobenzoyl)amino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C17H15FN2O4/c1-24-15(21)10-19-16(22)11-4-8-14(9-5-11)20-17(23)12-2-6-13(18)7-3-12/h2-9H,10H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | RXNLUGUTPPAVMP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |