C12H13F3N2O2S — CID 18145802
N-[2-(ethylamino)-2-oxoethyl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 18145802) has the molecular formula C12H13F3N2O2S and a molecular weight of 306.31 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxoethyl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[2-(ethylamino)-2-oxoethyl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 18145802 |
| Molecular Formula | C12H13F3N2O2S |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | N-[2-(ethylamino)-2-oxoethyl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | CCNC(=O)CNC(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H13F3N2O2S/c1-2-16-10(18)7-17-11(19)8-3-5-9(6-4-8)20-12(13,14)15/h3-6H,2,7H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | YKDGZOWHUQANKS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |