C16H13F3N2O2S — CID 9086775
4-methyl-N'-[4-(trifluoromethylsulfanyl)benzoyl]benzohydrazide (PubChem CID 9086775) has the molecular formula C16H13F3N2O2S and a molecular weight of 354.35 g/mol. Its IUPAC name is 4-methyl-N'-[4-(trifluoromethylsulfanyl)benzoyl]benzohydrazide.
| Compound Name | 4-methyl-N'-[4-(trifluoromethylsulfanyl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 9086775 |
| Molecular Formula | C16H13F3N2O2S |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.06 |
| IUPAC Name | 4-methyl-N'-[4-(trifluoromethylsulfanyl)benzoyl]benzohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)c2ccc(SC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H13F3N2O2S/c1-10-2-4-11(5-3-10)14(22)20-21-15(23)12-6-8-13(9-7-12)24-16(17,18)19/h2-9H,1H3,(H,20,22)(H,21,23) |
| InChIKey | BDHAAMFNKYESJJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|