C17H16F3N3O2S — CID 18267359
N'-[2-(4-methylanilino)acetyl]-4-(trifluoromethylsulfanyl)benzohydrazide (PubChem CID 18267359) has the molecular formula C17H16F3N3O2S and a molecular weight of 383.40 g/mol. Its IUPAC name is N'-[2-(4-methylanilino)acetyl]-4-(trifluoromethylsulfanyl)benzohydrazide.
| Compound Name | N'-[2-(4-methylanilino)acetyl]-4-(trifluoromethylsulfanyl)benzohydrazide |
|---|---|
| PubChem CID | 18267359 |
| Molecular Formula | C17H16F3N3O2S |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | N'-[2-(4-methylanilino)acetyl]-4-(trifluoromethylsulfanyl)benzohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2ccc(SC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H16F3N3O2S/c1-11-2-6-13(7-3-11)21-10-15(24)22-23-16(25)12-4-8-14(9-5-12)26-17(18,19)20/h2-9,21H,10H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | FSKHDIIUNRRXRA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|