C16H15ClFN3O2 — CID 18140176
5-chloro-2-fluoro-N'-[2-(4-methylanilino)acetyl]benzohydrazide (PubChem CID 18140176) has the molecular formula C16H15ClFN3O2 and a molecular weight of 335.77 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N'-[2-(4-methylanilino)acetyl]benzohydrazide.
| Compound Name | 5-chloro-2-fluoro-N'-[2-(4-methylanilino)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 18140176 |
| Molecular Formula | C16H15ClFN3O2 |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 5-chloro-2-fluoro-N'-[2-(4-methylanilino)acetyl]benzohydrazide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)c2cc(Cl)ccc2F)cc1 |
| InChI | InChI=1S/C16H15ClFN3O2/c1-10-2-5-12(6-3-10)19-9-15(22)20-21-16(23)13-8-11(17)4-7-14(13)18/h2-8,19H,9H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | AJCVQNTVSIRVLV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|