C18H22N4O4 — CID 56502731
2,5-dimethyl-N-[2-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-2-oxoethyl]furan-3-carboxamide (PubChem CID 56502731) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2,5-dimethyl-N-[2-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-2-oxoethyl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[2-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-2-oxoethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 56502731 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2,5-dimethyl-N-[2-[2-[2-(4-methylanilino)acetyl]hydrazinyl]-2-oxoethyl]furan-3-carboxamide |
| SMILES | Cc1ccc(NCC(=O)NNC(=O)CNC(=O)c2cc(C)oc2C)cc1 |
| InChI | InChI=1S/C18H22N4O4/c1-11-4-6-14(7-5-11)19-9-16(23)21-22-17(24)10-20-18(25)15-8-12(2)26-13(15)3/h4-8,19H,9-10H2,1-3H3,(H,20,25)(H,21,23)(H,22,24) |
| InChIKey | KSWYCXQAGIMSSQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|