C17H19FN4O3S — CID 86822231
N-[2-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-2-oxoethyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 86822231) has the molecular formula C17H19FN4O3S and a molecular weight of 378.43 g/mol. Its IUPAC name is N-[2-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-2-oxoethyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-[2-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-2-oxoethyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 86822231 |
| Molecular Formula | C17H19FN4O3S |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-[2-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-2-oxoethyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(=O)NNC(=S)NCc2ccc(F)cc2)c(C)o1 |
| InChI | InChI=1S/C17H19FN4O3S/c1-10-7-14(11(2)25-10)16(24)19-9-15(23)21-22-17(26)20-8-12-3-5-13(18)6-4-12/h3-7H,8-9H2,1-2H3,(H,19,24)(H,21,23)(H2,20,22,26) |
| InChIKey | IYSJOUDCZMBXCA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|