C15H15FN4O2S2 — CID 8942076
N-[2-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 8942076) has the molecular formula C15H15FN4O2S2 and a molecular weight of 366.44 g/mol. Its IUPAC name is N-[2-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 8942076 |
| Molecular Formula | C15H15FN4O2S2 |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | N-[2-[2-[(4-fluorophenyl)methylcarbamothioyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)NNC(=S)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H15FN4O2S2/c16-11-5-3-10(4-6-11)8-18-15(23)20-19-13(21)9-17-14(22)12-2-1-7-24-12/h1-7H,8-9H2,(H,17,22)(H,19,21)(H2,18,20,23) |
| InChIKey | SDJGRCMPSJCJMZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|