C16H15FN2O4S — CID 3158551
(4-fluorophenyl)methyl 2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetate (PubChem CID 3158551) has the molecular formula C16H15FN2O4S and a molecular weight of 350.37 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetate.
| Compound Name | (4-fluorophenyl)methyl 2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 3158551 |
| Molecular Formula | C16H15FN2O4S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.07 |
| IUPAC Name | (4-fluorophenyl)methyl 2-[[2-(thiophene-2-carbonylamino)acetyl]amino]acetate |
| SMILES | O=C(CNC(=O)c1cccs1)NCC(=O)OCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H15FN2O4S/c17-12-5-3-11(4-6-12)10-23-15(21)9-18-14(20)8-19-16(22)13-2-1-7-24-13/h1-7H,8-10H2,(H,18,20)(H,19,22) |
| InChIKey | PCNHBCILYPFCHG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |